C29H39BN2O3 — CID 158548155
(2S)-2,3-dimethyl-1-[(2S,4S)-4-methyl-2-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-benzo[e]indol-2-yl]pyrrolidin-1-yl]butan-1-one (PubChem CID 158548155) has the molecular formula C29H39BN2O3 and a molecular weight of 474.45 g/mol. Its IUPAC name is (2S)-2,3-dimethyl-1-[(2S,4S)-4-methyl-2-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-benzo[e]indol-2-yl]pyrrolidin-1-yl]butan-1-one.
| Compound Name | (2S)-2,3-dimethyl-1-[(2S,4S)-4-methyl-2-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-benzo[e]indol-2-yl]pyrrolidin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 158548155 |
| Molecular Formula | C29H39BN2O3 |
| Molecular Weight | 474.45 g/mol |
| Exact Mass | 474.31 |
| IUPAC Name | (2S)-2,3-dimethyl-1-[(2S,4S)-4-methyl-2-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-benzo[e]indol-2-yl]pyrrolidin-1-yl]butan-1-one |
| SMILES | CC(C)[C@H](C)C(=O)N1C[C@@H](C)C[C@H]1C1=Nc2ccc3cc(B4OC(C)(C)C(C)(C)O4)ccc3c2C1 |
| InChI | InChI=1S/C29H39BN2O3/c1-17(2)19(4)27(33)32-16-18(3)13-26(32)25-15-23-22-11-10-21(14-20(22)9-12-24(23)31-25)30-34-28(5,6)29(7,8)35-30/h9-12,14,17-19,26H,13,15-16H2,1-8H3/t18-,19-,26-/m0/s1 |
| InChIKey | RLBBRWTZORRPIS-DGUDUIIESA-N |
| XLogP | 5.30 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.45 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|