C28H37BN2O3 — CID 157452908
(2S)-2,3-dimethyl-1-[(2S)-2-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-benzo[e]indol-2-yl]pyrrolidin-1-yl]butan-1-one (PubChem CID 157452908) has the molecular formula C28H37BN2O3 and a molecular weight of 460.43 g/mol. Its IUPAC name is (2S)-2,3-dimethyl-1-[(2S)-2-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-benzo[e]indol-2-yl]pyrrolidin-1-yl]butan-1-one.
| Compound Name | (2S)-2,3-dimethyl-1-[(2S)-2-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-benzo[e]indol-2-yl]pyrrolidin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 157452908 |
| Molecular Formula | C28H37BN2O3 |
| Molecular Weight | 460.43 g/mol |
| Exact Mass | 460.29 |
| IUPAC Name | (2S)-2,3-dimethyl-1-[(2S)-2-[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-benzo[e]indol-2-yl]pyrrolidin-1-yl]butan-1-one |
| SMILES | CC(C)[C@H](C)C(=O)N1CCC[C@H]1C1=Nc2ccc3cc(B4OC(C)(C)C(C)(C)O4)ccc3c2C1 |
| InChI | InChI=1S/C28H37BN2O3/c1-17(2)18(3)26(32)31-14-8-9-25(31)24-16-22-21-12-11-20(15-19(21)10-13-23(22)30-24)29-33-27(4,5)28(6,7)34-29/h10-13,15,17-18,25H,8-9,14,16H2,1-7H3/t18-,25-/m0/s1 |
| InChIKey | QVXOMRHZTOELRY-BVZFJXPGSA-N |
| XLogP | 5.05 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.43 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|