About 1-tert-butyl-1-propan-2-ylcyclopropane;1,2-ditert-butylcyclobutane
1-tert-butyl-1-propan-2-ylcyclopropane;1,2-ditert-butylcyclobutane (PubChem CID 157384228) has the molecular formula C22H44
and a molecular weight of 308.59 g/mol. Its IUPAC name is 1-tert-butyl-1-propan-2-ylcyclopropane;1,2-ditert-butylcyclobutane.
Molecular Properties
| Compound Name | 1-tert-butyl-1-propan-2-ylcyclopropane;1,2-ditert-butylcyclobutane |
| PubChem CID | 157384228 |
| Molecular Formula | C22H44 |
| Molecular Weight | 308.59 g/mol |
| Exact Mass | 308.34 |
| IUPAC Name | 1-tert-butyl-1-propan-2-ylcyclopropane;1,2-ditert-butylcyclobutane |
| SMILES | CC(C)(C)C1CCC1C(C)(C)C.CC(C)C1(C(C)(C)C)CC1 |
| InChI | InChI=1S/C12H24.C10H20/c1-11(2,3)9-7-8-10(9)12(4,5)6;1-8(2)10(6-7-10)9(3,4)5/h9-10H,7-8H2,1-6H3;8H,6-7H2,1-5H3 |
| InChIKey | BLFVWXVOKHOLHF-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 308.59 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-tert-butyl-1-propan-2-ylcyclopropane;1,2-ditert-butylcyclobutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butyl-1-propan-2-ylcyclopropane;1,2-ditert-butylcyclobutane?
The IUPAC name of 1-tert-butyl-1-propan-2-ylcyclopropane;1,2-ditert-butylcyclobutane (CID 157384228) is 1-tert-butyl-1-propan-2-ylcyclopropane;1,2-ditert-butylcyclobutane.
What is the SMILES notation for 1-tert-butyl-1-propan-2-ylcyclopropane;1,2-ditert-butylcyclobutane?
The canonical SMILES for 1-tert-butyl-1-propan-2-ylcyclopropane;1,2-ditert-butylcyclobutane is CC(C)(C)C1CCC1C(C)(C)C.CC(C)C1(C(C)(C)C)CC1.
What is the InChIKey of 1-tert-butyl-1-propan-2-ylcyclopropane;1,2-ditert-butylcyclobutane?
The InChIKey is BLFVWXVOKHOLHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24.C10H20/c1-11(2,3)9-7-8-10(9)12(4,5)6;1-8(2)10(6-7-10)9(3,4)5/h9-10H,7-8H2,1-6H3;8H,6-7H2,1-5H3.
What are the key properties of 1-tert-butyl-1-propan-2-ylcyclopropane;1,2-ditert-butylcyclobutane?
1-tert-butyl-1-propan-2-ylcyclopropane;1,2-ditert-butylcyclobutane has a molecular weight of 308.59 g/mol, XLogP of 7.57, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butyl-1-propan-2-ylcyclopropane;1,2-ditert-butylcyclobutane is sourced from PubChem (CID 157384228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).