About carbanide;dimethyl(naphthalen-1-yl)sulfanium;ethane
carbanide;dimethyl(naphthalen-1-yl)sulfanium;ethane (PubChem CID 157387022) has the molecular formula C15H22S
and a molecular weight of 234.41 g/mol. Its IUPAC name is carbanide;dimethyl(naphthalen-1-yl)sulfanium;ethane.
Molecular Properties
| Compound Name | carbanide;dimethyl(naphthalen-1-yl)sulfanium;ethane |
| PubChem CID | 157387022 |
| Molecular Formula | C15H22S |
| Molecular Weight | 234.41 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | carbanide;dimethyl(naphthalen-1-yl)sulfanium;ethane |
| SMILES | CC.C[S+](C)c1cccc2ccccc12.[CH3-] |
| InChI | InChI=1S/C12H13S.C2H6.CH3/c1-13(2)12-9-5-7-10-6-3-4-8-11(10)12;1-2;/h3-9H,1-2H3;1-2H3;1H3/q+1;;-1 |
| InChIKey | BLOCFGRWWUZCKY-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.41 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze carbanide;dimethyl(naphthalen-1-yl)sulfanium;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbanide;dimethyl(naphthalen-1-yl)sulfanium;ethane?
The IUPAC name of carbanide;dimethyl(naphthalen-1-yl)sulfanium;ethane (CID 157387022) is carbanide;dimethyl(naphthalen-1-yl)sulfanium;ethane.
What is the SMILES notation for carbanide;dimethyl(naphthalen-1-yl)sulfanium;ethane?
The canonical SMILES for carbanide;dimethyl(naphthalen-1-yl)sulfanium;ethane is CC.C[S+](C)c1cccc2ccccc12.[CH3-].
What is the InChIKey of carbanide;dimethyl(naphthalen-1-yl)sulfanium;ethane?
The InChIKey is BLOCFGRWWUZCKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13S.C2H6.CH3/c1-13(2)12-9-5-7-10-6-3-4-8-11(10)12;1-2;/h3-9H,1-2H3;1-2H3;1H3/q+1;;-1.
What are the key properties of carbanide;dimethyl(naphthalen-1-yl)sulfanium;ethane?
carbanide;dimethyl(naphthalen-1-yl)sulfanium;ethane has a molecular weight of 234.41 g/mol, XLogP of 4.55, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for carbanide;dimethyl(naphthalen-1-yl)sulfanium;ethane is sourced from PubChem (CID 157387022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).