About diethyl(naphthalen-1-yl)sulfanium;fluoroform
diethyl(naphthalen-1-yl)sulfanium;fluoroform (PubChem CID 162621913) has the molecular formula C15H18F3S+
and a molecular weight of 287.37 g/mol. Its IUPAC name is diethyl(naphthalen-1-yl)sulfanium;fluoroform.
Molecular Properties
| Compound Name | diethyl(naphthalen-1-yl)sulfanium;fluoroform |
| PubChem CID | 162621913 |
| Molecular Formula | C15H18F3S+ |
| Molecular Weight | 287.37 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | diethyl(naphthalen-1-yl)sulfanium;fluoroform |
| SMILES | CC[S+](CC)c1cccc2ccccc12.FC(F)F |
| InChI | InChI=1S/C14H17S.CHF3/c1-3-15(4-2)14-11-7-9-12-8-5-6-10-13(12)14;2-1(3)4/h5-11H,3-4H2,1-2H3;1H/q+1; |
| InChIKey | YVJGLRZVMIUUSC-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 287.37 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze diethyl(naphthalen-1-yl)sulfanium;fluoroform with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl(naphthalen-1-yl)sulfanium;fluoroform?
The IUPAC name of diethyl(naphthalen-1-yl)sulfanium;fluoroform (CID 162621913) is diethyl(naphthalen-1-yl)sulfanium;fluoroform.
What is the SMILES notation for diethyl(naphthalen-1-yl)sulfanium;fluoroform?
The canonical SMILES for diethyl(naphthalen-1-yl)sulfanium;fluoroform is CC[S+](CC)c1cccc2ccccc12.FC(F)F.
What is the InChIKey of diethyl(naphthalen-1-yl)sulfanium;fluoroform?
The InChIKey is YVJGLRZVMIUUSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17S.CHF3/c1-3-15(4-2)14-11-7-9-12-8-5-6-10-13(12)14;2-1(3)4/h5-11H,3-4H2,1-2H3;1H/q+1;.
What are the key properties of diethyl(naphthalen-1-yl)sulfanium;fluoroform?
diethyl(naphthalen-1-yl)sulfanium;fluoroform has a molecular weight of 287.37 g/mol, XLogP of 5.04, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl(naphthalen-1-yl)sulfanium;fluoroform is sourced from PubChem (CID 162621913), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).