About dimethyl(naphthalen-1-yl)sulfanium;ethane;propane
dimethyl(naphthalen-1-yl)sulfanium;ethane;propane (PubChem CID 169429862) has the molecular formula C17H27S+
and a molecular weight of 263.47 g/mol. Its IUPAC name is dimethyl(naphthalen-1-yl)sulfanium;ethane;propane.
Molecular Properties
| Compound Name | dimethyl(naphthalen-1-yl)sulfanium;ethane;propane |
| PubChem CID | 169429862 |
| Molecular Formula | C17H27S+ |
| Molecular Weight | 263.47 g/mol |
| Exact Mass | 263.18 |
| IUPAC Name | dimethyl(naphthalen-1-yl)sulfanium;ethane;propane |
| SMILES | CC.CCC.C[S+](C)c1cccc2ccccc12 |
| InChI | InChI=1S/C12H13S.C3H8.C2H6/c1-13(2)12-9-5-7-10-6-3-4-8-11(10)12;1-3-2;1-2/h3-9H,1-2H3;3H2,1-2H3;1-2H3/q+1;; |
| InChIKey | SJFOBMIWWYUVQA-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 263.47 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze dimethyl(naphthalen-1-yl)sulfanium;ethane;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl(naphthalen-1-yl)sulfanium;ethane;propane?
The IUPAC name of dimethyl(naphthalen-1-yl)sulfanium;ethane;propane (CID 169429862) is dimethyl(naphthalen-1-yl)sulfanium;ethane;propane.
What is the SMILES notation for dimethyl(naphthalen-1-yl)sulfanium;ethane;propane?
The canonical SMILES for dimethyl(naphthalen-1-yl)sulfanium;ethane;propane is CC.CCC.C[S+](C)c1cccc2ccccc12.
What is the InChIKey of dimethyl(naphthalen-1-yl)sulfanium;ethane;propane?
The InChIKey is SJFOBMIWWYUVQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13S.C3H8.C2H6/c1-13(2)12-9-5-7-10-6-3-4-8-11(10)12;1-3-2;1-2/h3-9H,1-2H3;3H2,1-2H3;1-2H3/q+1;;.
What are the key properties of dimethyl(naphthalen-1-yl)sulfanium;ethane;propane?
dimethyl(naphthalen-1-yl)sulfanium;ethane;propane has a molecular weight of 263.47 g/mol, XLogP of 5.52, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl(naphthalen-1-yl)sulfanium;ethane;propane is sourced from PubChem (CID 169429862), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).