About phenylmethoxycarbamic acid
phenylmethoxycarbamic acid (PubChem CID 15739368) has the molecular formula C8H9NO3
and a molecular weight of 167.16 g/mol. Its IUPAC name is phenylmethoxycarbamic acid.
Molecular Properties
| Compound Name | phenylmethoxycarbamic acid |
| PubChem CID | 15739368 |
| Molecular Formula | C8H9NO3 |
| Molecular Weight | 167.16 g/mol |
| Exact Mass | 167.06 |
| IUPAC Name | phenylmethoxycarbamic acid |
| SMILES | O=C(O)NOCc1ccccc1 |
| InChI | InChI=1S/C8H9NO3/c10-8(11)9-12-6-7-4-2-1-3-5-7/h1-5,9H,6H2,(H,10,11) |
| InChIKey | OSHXXOCGXCIKKN-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.16 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze phenylmethoxycarbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenylmethoxycarbamic acid?
The IUPAC name of phenylmethoxycarbamic acid (CID 15739368) is phenylmethoxycarbamic acid.
What is the SMILES notation for phenylmethoxycarbamic acid?
The canonical SMILES for phenylmethoxycarbamic acid is O=C(O)NOCc1ccccc1.
What is the InChIKey of phenylmethoxycarbamic acid?
The InChIKey is OSHXXOCGXCIKKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO3/c10-8(11)9-12-6-7-4-2-1-3-5-7/h1-5,9H,6H2,(H,10,11).
What are the key properties of phenylmethoxycarbamic acid?
phenylmethoxycarbamic acid has a molecular weight of 167.16 g/mol, XLogP of 1.39, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for phenylmethoxycarbamic acid is sourced from PubChem (CID 15739368), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).