C31H32F2O5S2 — CID 157422845
1-adamantylmethyl 2,2-difluoro-2-oxidoperoxysulfanylacetate;triphenylsulfanium (PubChem CID 157422845) has the molecular formula C31H32F2O5S2 and a molecular weight of 586.72 g/mol. Its IUPAC name is 1-adamantylmethyl 2,2-difluoro-2-oxidoperoxysulfanylacetate;triphenylsulfanium.
| Compound Name | 1-adamantylmethyl 2,2-difluoro-2-oxidoperoxysulfanylacetate;triphenylsulfanium |
|---|---|
| PubChem CID | 157422845 |
| Molecular Formula | C31H32F2O5S2 |
| Molecular Weight | 586.72 g/mol |
| Exact Mass | 586.17 |
| IUPAC Name | 1-adamantylmethyl 2,2-difluoro-2-oxidoperoxysulfanylacetate;triphenylsulfanium |
| SMILES | O=C(OCC12CC3CC(CC(C3)C1)C2)C(F)(F)SOO[O-].c1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15S.C13H18F2O5S/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;14-13(15,21-20-19-17)11(16)18-7-12-4-8-1-9(5-12)3-10(2-8)6-12/h1-15H;8-10,17H,1-7H2/q+1;/p-1 |
| InChIKey | BPPPRBQFYNKDRD-UHFFFAOYSA-M |
| XLogP | 6.99 |
| TPSA | 67.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.72 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|