C26H30ClNO5S — CID 157451238
1-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-3-ethyl-5-methyl-4-(4-methylphenyl)sulfonylpyrrole-2-carboxylic acid (PubChem CID 157451238) has the molecular formula C26H30ClNO5S and a molecular weight of 504.05 g/mol. Its IUPAC name is 1-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-3-ethyl-5-methyl-4-(4-methylphenyl)sulfonylpyrrole-2-carboxylic acid.
| Compound Name | 1-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-3-ethyl-5-methyl-4-(4-methylphenyl)sulfonylpyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 157451238 |
| Molecular Formula | C26H30ClNO5S |
| Molecular Weight | 504.05 g/mol |
| Exact Mass | 503.15 |
| IUPAC Name | 1-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-3-ethyl-5-methyl-4-(4-methylphenyl)sulfonylpyrrole-2-carboxylic acid |
| SMILES | CCc1c(S(=O)(=O)c2ccc(C)cc2)c(C)n(CCCOc2cc(C)c(Cl)c(C)c2)c1C(=O)O |
| InChI | InChI=1S/C26H30ClNO5S/c1-6-22-24(26(29)30)28(12-7-13-33-20-14-17(3)23(27)18(4)15-20)19(5)25(22)34(31,32)21-10-8-16(2)9-11-21/h8-11,14-15H,6-7,12-13H2,1-5H3,(H,29,30) |
| InChIKey | BSVFLUAJSVDNAE-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 85.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.05 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|