C24H25ClFNO5S — CID 158393534
1-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-4-(4-fluorophenyl)sulfonyl-3,5-dimethylpyrrole-2-carboxylic acid (PubChem CID 158393534) has the molecular formula C24H25ClFNO5S and a molecular weight of 493.98 g/mol. Its IUPAC name is 1-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-4-(4-fluorophenyl)sulfonyl-3,5-dimethylpyrrole-2-carboxylic acid.
| Compound Name | 1-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-4-(4-fluorophenyl)sulfonyl-3,5-dimethylpyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 158393534 |
| Molecular Formula | C24H25ClFNO5S |
| Molecular Weight | 493.98 g/mol |
| Exact Mass | 493.11 |
| IUPAC Name | 1-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-4-(4-fluorophenyl)sulfonyl-3,5-dimethylpyrrole-2-carboxylic acid |
| SMILES | Cc1cc(OCCCn2c(C)c(S(=O)(=O)c3ccc(F)cc3)c(C)c2C(=O)O)cc(C)c1Cl |
| InChI | InChI=1S/C24H25ClFNO5S/c1-14-12-19(13-15(2)21(14)25)32-11-5-10-27-17(4)23(16(3)22(27)24(28)29)33(30,31)20-8-6-18(26)7-9-20/h6-9,12-13H,5,10-11H2,1-4H3,(H,28,29) |
| InChIKey | GXGMIUIGEUDZJY-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 85.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.98 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|