C22H24ClNO5S2 — CID 158543106
1-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-3,5-dimethyl-4-thiophen-2-ylsulfonylpyrrole-2-carboxylic acid (PubChem CID 158543106) has the molecular formula C22H24ClNO5S2 and a molecular weight of 482.02 g/mol. Its IUPAC name is 1-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-3,5-dimethyl-4-thiophen-2-ylsulfonylpyrrole-2-carboxylic acid.
| Compound Name | 1-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-3,5-dimethyl-4-thiophen-2-ylsulfonylpyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 158543106 |
| Molecular Formula | C22H24ClNO5S2 |
| Molecular Weight | 482.02 g/mol |
| Exact Mass | 481.08 |
| IUPAC Name | 1-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-3,5-dimethyl-4-thiophen-2-ylsulfonylpyrrole-2-carboxylic acid |
| SMILES | Cc1cc(OCCCn2c(C)c(S(=O)(=O)c3cccs3)c(C)c2C(=O)O)cc(C)c1Cl |
| InChI | InChI=1S/C22H24ClNO5S2/c1-13-11-17(12-14(2)19(13)23)29-9-6-8-24-16(4)21(15(3)20(24)22(25)26)31(27,28)18-7-5-10-30-18/h5,7,10-12H,6,8-9H2,1-4H3,(H,25,26) |
| InChIKey | HOTQVQYCNRBOOE-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 85.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.02 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|