C25H28ClNO6S — CID 158765103
1-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-4-(2-methoxyphenyl)sulfonyl-3,5-dimethylpyrrole-2-carboxylic acid (PubChem CID 158765103) has the molecular formula C25H28ClNO6S and a molecular weight of 506.02 g/mol. Its IUPAC name is 1-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-4-(2-methoxyphenyl)sulfonyl-3,5-dimethylpyrrole-2-carboxylic acid.
| Compound Name | 1-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-4-(2-methoxyphenyl)sulfonyl-3,5-dimethylpyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 158765103 |
| Molecular Formula | C25H28ClNO6S |
| Molecular Weight | 506.02 g/mol |
| Exact Mass | 505.13 |
| IUPAC Name | 1-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-4-(2-methoxyphenyl)sulfonyl-3,5-dimethylpyrrole-2-carboxylic acid |
| SMILES | COc1ccccc1S(=O)(=O)c1c(C)c(C(=O)O)n(CCCOc2cc(C)c(Cl)c(C)c2)c1C |
| InChI | InChI=1S/C25H28ClNO6S/c1-15-13-19(14-16(2)22(15)26)33-12-8-11-27-18(4)24(17(3)23(27)25(28)29)34(30,31)21-10-7-6-9-20(21)32-5/h6-7,9-10,13-14H,8,11-12H2,1-5H3,(H,28,29) |
| InChIKey | IPDSUNGPTLNIFE-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.02 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|