C28H34ClNO5S — CID 158189294
4-(4-tert-butylphenyl)sulfonyl-1-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-3,5-dimethylpyrrole-2-carboxylic acid (PubChem CID 158189294) has the molecular formula C28H34ClNO5S and a molecular weight of 532.10 g/mol. Its IUPAC name is 4-(4-tert-butylphenyl)sulfonyl-1-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-3,5-dimethylpyrrole-2-carboxylic acid.
| Compound Name | 4-(4-tert-butylphenyl)sulfonyl-1-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-3,5-dimethylpyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 158189294 |
| Molecular Formula | C28H34ClNO5S |
| Molecular Weight | 532.10 g/mol |
| Exact Mass | 531.18 |
| IUPAC Name | 4-(4-tert-butylphenyl)sulfonyl-1-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-3,5-dimethylpyrrole-2-carboxylic acid |
| SMILES | Cc1cc(OCCCn2c(C)c(S(=O)(=O)c3ccc(C(C)(C)C)cc3)c(C)c2C(=O)O)cc(C)c1Cl |
| InChI | InChI=1S/C28H34ClNO5S/c1-17-15-22(16-18(2)24(17)29)35-14-8-13-30-20(4)26(19(3)25(30)27(31)32)36(33,34)23-11-9-21(10-12-23)28(5,6)7/h9-12,15-16H,8,13-14H2,1-7H3,(H,31,32) |
| InChIKey | FZNUNTLNQMKJGP-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 85.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.10 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|