C21H36O4 — CID 157454998
7-[2,2-dimethyl-3-(2-methyl-5-oxohept-6-enoxy)propoxy]-6-methylhept-1-en-3-one (PubChem CID 157454998) has the molecular formula C21H36O4 and a molecular weight of 352.52 g/mol. Its IUPAC name is 7-[2,2-dimethyl-3-(2-methyl-5-oxohept-6-enoxy)propoxy]-6-methylhept-1-en-3-one.
| Compound Name | 7-[2,2-dimethyl-3-(2-methyl-5-oxohept-6-enoxy)propoxy]-6-methylhept-1-en-3-one |
|---|---|
| PubChem CID | 157454998 |
| Molecular Formula | C21H36O4 |
| Molecular Weight | 352.52 g/mol |
| Exact Mass | 352.26 |
| IUPAC Name | 7-[2,2-dimethyl-3-(2-methyl-5-oxohept-6-enoxy)propoxy]-6-methylhept-1-en-3-one |
| SMILES | C=CC(=O)CCC(C)COCC(C)(C)COCC(C)CCC(=O)C=C |
| InChI | InChI=1S/C21H36O4/c1-7-19(22)11-9-17(3)13-24-15-21(5,6)16-25-14-18(4)10-12-20(23)8-2/h7-8,17-18H,1-2,9-16H2,3-6H3 |
| InChIKey | MRRBCMWSNXHQCC-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.52 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|