About potassium;acetic acid;phenylazanide
potassium;acetic acid;phenylazanide (PubChem CID 157465030) has the molecular formula C8H10KNO2
and a molecular weight of 191.27 g/mol. Its IUPAC name is potassium;acetic acid;phenylazanide.
Molecular Properties
| Compound Name | potassium;acetic acid;phenylazanide |
| PubChem CID | 157465030 |
| Molecular Formula | C8H10KNO2 |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.03 |
| IUPAC Name | potassium;acetic acid;phenylazanide |
| SMILES | CC(=O)O.[K+].[NH-]c1ccccc1 |
| InChI | InChI=1S/C6H6N.C2H4O2.K/c7-6-4-2-1-3-5-6;1-2(3)4;/h1-5,7H;1H3,(H,3,4);/q-1;;+1 |
| InChIKey | BUJGUZQIRHSZSY-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 61.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze potassium;acetic acid;phenylazanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;acetic acid;phenylazanide?
The IUPAC name of potassium;acetic acid;phenylazanide (CID 157465030) is potassium;acetic acid;phenylazanide.
What is the SMILES notation for potassium;acetic acid;phenylazanide?
The canonical SMILES for potassium;acetic acid;phenylazanide is CC(=O)O.[K+].[NH-]c1ccccc1.
What is the InChIKey of potassium;acetic acid;phenylazanide?
The InChIKey is BUJGUZQIRHSZSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N.C2H4O2.K/c7-6-4-2-1-3-5-6;1-2(3)4;/h1-5,7H;1H3,(H,3,4);/q-1;;+1.
What are the key properties of potassium;acetic acid;phenylazanide?
potassium;acetic acid;phenylazanide has a molecular weight of 191.27 g/mol, XLogP of -0.53, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;acetic acid;phenylazanide is sourced from PubChem (CID 157465030), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).