C18H21F3N2O2S2 — CID 157465769
8,8,8-trifluoro-1-[5-(2-methylpropyl)-2-(1,3-thiazol-2-yl)-1,3-thiazol-4-yl]octane-1,7-dione (PubChem CID 157465769) has the molecular formula C18H21F3N2O2S2 and a molecular weight of 418.51 g/mol. Its IUPAC name is 8,8,8-trifluoro-1-[5-(2-methylpropyl)-2-(1,3-thiazol-2-yl)-1,3-thiazol-4-yl]octane-1,7-dione.
| Compound Name | 8,8,8-trifluoro-1-[5-(2-methylpropyl)-2-(1,3-thiazol-2-yl)-1,3-thiazol-4-yl]octane-1,7-dione |
|---|---|
| PubChem CID | 157465769 |
| Molecular Formula | C18H21F3N2O2S2 |
| Molecular Weight | 418.51 g/mol |
| Exact Mass | 418.10 |
| IUPAC Name | 8,8,8-trifluoro-1-[5-(2-methylpropyl)-2-(1,3-thiazol-2-yl)-1,3-thiazol-4-yl]octane-1,7-dione |
| SMILES | CC(C)Cc1sc(-c2nccs2)nc1C(=O)CCCCCC(=O)C(F)(F)F |
| InChI | InChI=1S/C18H21F3N2O2S2/c1-11(2)10-13-15(23-17(27-13)16-22-8-9-26-16)12(24)6-4-3-5-7-14(25)18(19,20)21/h8-9,11H,3-7,10H2,1-2H3 |
| InChIKey | SCOXMUGVDGBEDP-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.51 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|