C29H46N4O5Si — CID 157483557
tert-butyl 3-[[1-methyl-2-oxo-3-(2-trimethylsilylethoxymethyl)-1,5-dihydro-[1,2,4]triazino[3,4-c][1,4]benzoxazin-9-yl]methyl]-3-propan-2-ylazetidine-1-carboxylate (PubChem CID 157483557) has the molecular formula C29H46N4O5Si and a molecular weight of 558.80 g/mol. Its IUPAC name is tert-butyl 3-[[1-methyl-2-oxo-3-(2-trimethylsilylethoxymethyl)-1,5-dihydro-[1,2,4]triazino[3,4-c][1,4]benzoxazin-9-yl]methyl]-3-propan-2-ylazetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[1-methyl-2-oxo-3-(2-trimethylsilylethoxymethyl)-1,5-dihydro-[1,2,4]triazino[3,4-c][1,4]benzoxazin-9-yl]methyl]-3-propan-2-ylazetidine-1-carboxylate |
|---|---|
| PubChem CID | 157483557 |
| Molecular Formula | C29H46N4O5Si |
| Molecular Weight | 558.80 g/mol |
| Exact Mass | 558.32 |
| IUPAC Name | tert-butyl 3-[[1-methyl-2-oxo-3-(2-trimethylsilylethoxymethyl)-1,5-dihydro-[1,2,4]triazino[3,4-c][1,4]benzoxazin-9-yl]methyl]-3-propan-2-ylazetidine-1-carboxylate |
| SMILES | CC1C(=O)N(COCC[Si](C)(C)C)N=C2COc3ccc(CC4(C(C)C)CN(C(=O)OC(C)(C)C)C4)cc3N21 |
| InChI | InChI=1S/C29H46N4O5Si/c1-20(2)29(17-31(18-29)27(35)38-28(4,5)6)15-22-10-11-24-23(14-22)33-21(3)26(34)32(30-25(33)16-37-24)19-36-12-13-39(7,8)9/h10-11,14,20-21H,12-13,15-19H2,1-9H3 |
| InChIKey | LELLLDNZLZPSJX-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 83.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.80 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|