C26H41N5O5Si — CID 86727593
tert-butyl 4-[1-methyl-2-oxo-3-(2-trimethylsilylethoxymethyl)-1,5-dihydro-[1,2,4]triazino[3,4-c][1,4]benzoxazin-9-yl]piperazine-1-carboxylate (PubChem CID 86727593) has the molecular formula C26H41N5O5Si and a molecular weight of 531.73 g/mol. Its IUPAC name is tert-butyl 4-[1-methyl-2-oxo-3-(2-trimethylsilylethoxymethyl)-1,5-dihydro-[1,2,4]triazino[3,4-c][1,4]benzoxazin-9-yl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[1-methyl-2-oxo-3-(2-trimethylsilylethoxymethyl)-1,5-dihydro-[1,2,4]triazino[3,4-c][1,4]benzoxazin-9-yl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 86727593 |
| Molecular Formula | C26H41N5O5Si |
| Molecular Weight | 531.73 g/mol |
| Exact Mass | 531.29 |
| IUPAC Name | tert-butyl 4-[1-methyl-2-oxo-3-(2-trimethylsilylethoxymethyl)-1,5-dihydro-[1,2,4]triazino[3,4-c][1,4]benzoxazin-9-yl]piperazine-1-carboxylate |
| SMILES | CC1C(=O)N(COCC[Si](C)(C)C)N=C2COc3ccc(N4CCN(C(=O)OC(C)(C)C)CC4)cc3N21 |
| InChI | InChI=1S/C26H41N5O5Si/c1-19-24(32)30(18-34-14-15-37(5,6)7)27-23-17-35-22-9-8-20(16-21(22)31(19)23)28-10-12-29(13-11-28)25(33)36-26(2,3)4/h8-9,16,19H,10-15,17-18H2,1-7H3 |
| InChIKey | OWIJETUZOWWWAD-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 87.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.73 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|