C11H11NO6S — CID 157492207
(6-cyano-5,5-dioxo-4,8-dioxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-9-yl) (E)-but-2-enoate (PubChem CID 157492207) has the molecular formula C11H11NO6S and a molecular weight of 285.28 g/mol. Its IUPAC name is (6-cyano-5,5-dioxo-4,8-dioxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-9-yl) (E)-but-2-enoate.
| Compound Name | (6-cyano-5,5-dioxo-4,8-dioxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-9-yl) (E)-but-2-enoate |
|---|---|
| PubChem CID | 157492207 |
| Molecular Formula | C11H11NO6S |
| Molecular Weight | 285.28 g/mol |
| Exact Mass | 285.03 |
| IUPAC Name | (6-cyano-5,5-dioxo-4,8-dioxa-5λ6-thiatricyclo[4.2.1.03,7]nonan-9-yl) (E)-but-2-enoate |
| SMILES | C/C=C/C(=O)OC1C2CC3OS(=O)(=O)C1(C#N)C3O2 |
| InChI | InChI=1S/C11H11NO6S/c1-2-3-8(13)17-9-6-4-7-10(16-6)11(9,5-12)19(14,15)18-7/h2-3,6-7,9-10H,4H2,1H3/b3-2+ |
| InChIKey | BXKKFKUUUSDBEW-NSCUHMNNSA-N |
| XLogP | -0.36 |
| TPSA | 102.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.28 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|