C11H9N5O5 — CID 15750127
3-methyl-7-nitrospiro[1H-quinazoline-4,5'-imidazolidine]-2,2',4'-trione (PubChem CID 15750127) has the molecular formula C11H9N5O5 and a molecular weight of 291.22 g/mol. Its IUPAC name is 3-methyl-7-nitrospiro[1H-quinazoline-4,5'-imidazolidine]-2,2',4'-trione.
| Compound Name | 3-methyl-7-nitrospiro[1H-quinazoline-4,5'-imidazolidine]-2,2',4'-trione |
|---|---|
| PubChem CID | 15750127 |
| Molecular Formula | C11H9N5O5 |
| Molecular Weight | 291.22 g/mol |
| Exact Mass | 291.06 |
| IUPAC Name | 3-methyl-7-nitrospiro[1H-quinazoline-4,5'-imidazolidine]-2,2',4'-trione |
| SMILES | CN1C(=O)Nc2cc([N+](=O)[O-])ccc2C12NC(=O)NC2=O |
| InChI | InChI=1S/C11H9N5O5/c1-15-10(19)12-7-4-5(16(20)21)2-3-6(7)11(15)8(17)13-9(18)14-11/h2-4H,1H3,(H,12,19)(H2,13,14,17,18) |
| InChIKey | VERGEGRCVIWWNH-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 133.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.22 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|