C26H21Cl2F6N3O5S — CID 158017401
1-(2-amino-5-chlorophenyl)-2,2,2-trifluoroethanone;N-[3-[6-chloro-2-oxo-4-(trifluoromethyl)-1H-3,1-benzoxazin-4-yl]propyl]benzenesulfonamide (PubChem CID 158017401) has the molecular formula C26H21Cl2F6N3O5S and a molecular weight of 672.43 g/mol. Its IUPAC name is 1-(2-amino-5-chlorophenyl)-2,2,2-trifluoroethanone;N-[3-[6-chloro-2-oxo-4-(trifluoromethyl)-1H-3,1-benzoxazin-4-yl]propyl]benzenesulfonamide.
| Compound Name | 1-(2-amino-5-chlorophenyl)-2,2,2-trifluoroethanone;N-[3-[6-chloro-2-oxo-4-(trifluoromethyl)-1H-3,1-benzoxazin-4-yl]propyl]benzenesulfonamide |
|---|---|
| PubChem CID | 158017401 |
| Molecular Formula | C26H21Cl2F6N3O5S |
| Molecular Weight | 672.43 g/mol |
| Exact Mass | 671.05 |
| IUPAC Name | 1-(2-amino-5-chlorophenyl)-2,2,2-trifluoroethanone;N-[3-[6-chloro-2-oxo-4-(trifluoromethyl)-1H-3,1-benzoxazin-4-yl]propyl]benzenesulfonamide |
| SMILES | Nc1ccc(Cl)cc1C(=O)C(F)(F)F.O=C1Nc2ccc(Cl)cc2C(CCCNS(=O)(=O)c2ccccc2)(C(F)(F)F)O1 |
| InChI | InChI=1S/C18H16ClF3N2O4S.C8H5ClF3NO/c19-12-7-8-15-14(11-12)17(18(20,21)22,28-16(25)24-15)9-4-10-23-29(26,27)13-5-2-1-3-6-13;9-4-1-2-6(13)5(3-4)7(14)8(10,11)12/h1-3,5-8,11,23H,4,9-10H2,(H,24,25);1-3H,13H2 |
| InChIKey | FFQHBVDSMUHFCB-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 127.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.43 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|