C10H14KNO4 — CID 158042256
potassium (2R)-1-(4-methoxy-4-oxobut-2-en-2-yl)pyrrolidine-2-carboxylate (PubChem CID 158042256) has the molecular formula C10H14KNO4 and a molecular weight of 251.32 g/mol. Its IUPAC name is potassium (2R)-1-(4-methoxy-4-oxobut-2-en-2-yl)pyrrolidine-2-carboxylate.
| Compound Name | potassium (2R)-1-(4-methoxy-4-oxobut-2-en-2-yl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 158042256 |
| Molecular Formula | C10H14KNO4 |
| Molecular Weight | 251.32 g/mol |
| Exact Mass | 251.06 |
| IUPAC Name | potassium (2R)-1-(4-methoxy-4-oxobut-2-en-2-yl)pyrrolidine-2-carboxylate |
| SMILES | COC(=O)C=C(C)N1CCC[C@@H]1C(=O)[O-].[K+] |
| InChI | InChI=1S/C10H15NO4.K/c1-7(6-9(12)15-2)11-5-3-4-8(11)10(13)14;/h6,8H,3-5H2,1-2H3,(H,13,14);/q;+1/p-1/t8-;/m1./s1 |
| InChIKey | YJOJVPMOCQHXTM-DDWIOCJRSA-M |
| XLogP | -3.72 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.32 |
| LogP ≤ 5 | -3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|