C28H35FN4O7 — CID 158044058
(4-methoxyphenyl)methyl 4-[[7-[(6-(18F)fluoropyridine-3-carbonyl)amino]-2-oxoheptan-3-yl]carbamoylamino]-5-oxohexanoate (PubChem CID 158044058) has the molecular formula C28H35FN4O7 and a molecular weight of 557.61 g/mol. Its IUPAC name is (4-methoxyphenyl)methyl 4-[[7-[(6-(18F)fluoropyridine-3-carbonyl)amino]-2-oxoheptan-3-yl]carbamoylamino]-5-oxohexanoate.
| Compound Name | (4-methoxyphenyl)methyl 4-[[7-[(6-(18F)fluoropyridine-3-carbonyl)amino]-2-oxoheptan-3-yl]carbamoylamino]-5-oxohexanoate |
|---|---|
| PubChem CID | 158044058 |
| Molecular Formula | C28H35FN4O7 |
| Molecular Weight | 557.61 g/mol |
| Exact Mass | 557.25 |
| IUPAC Name | (4-methoxyphenyl)methyl 4-[[7-[(6-(18F)fluoropyridine-3-carbonyl)amino]-2-oxoheptan-3-yl]carbamoylamino]-5-oxohexanoate |
| SMILES | COc1ccc(COC(=O)CCC(NC(=O)NC(CCCCNC(=O)c2ccc([18F])nc2)C(C)=O)C(C)=O)cc1 |
| InChI | InChI=1S/C28H35FN4O7/c1-18(34)23(6-4-5-15-30-27(37)21-9-13-25(29)31-16-21)32-28(38)33-24(19(2)35)12-14-26(36)40-17-20-7-10-22(39-3)11-8-20/h7-11,13,16,23-24H,4-6,12,14-15,17H2,1-3H3,(H,30,37)(H2,32,33,38)/i29-1 |
| InChIKey | FIRQVQFTQJBLDD-GBHUPVCCSA-N |
| XLogP | 2.87 |
| TPSA | 152.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.61 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|