C17H23F9O2S2 — CID 158048963
2-[2-(3,3,5,5,7,7,9,9,9-nonafluorononylsulfanyl)ethylsulfanyl]ethyl 2-methylprop-2-enoate (PubChem CID 158048963) has the molecular formula C17H23F9O2S2 and a molecular weight of 494.49 g/mol. Its IUPAC name is 2-[2-(3,3,5,5,7,7,9,9,9-nonafluorononylsulfanyl)ethylsulfanyl]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[2-(3,3,5,5,7,7,9,9,9-nonafluorononylsulfanyl)ethylsulfanyl]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 158048963 |
| Molecular Formula | C17H23F9O2S2 |
| Molecular Weight | 494.49 g/mol |
| Exact Mass | 494.10 |
| IUPAC Name | 2-[2-(3,3,5,5,7,7,9,9,9-nonafluorononylsulfanyl)ethylsulfanyl]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCSCCSCCC(F)(F)CC(F)(F)CC(F)(F)CC(F)(F)F |
| InChI | InChI=1S/C17H23F9O2S2/c1-12(2)13(27)28-4-6-30-8-7-29-5-3-14(18,19)9-15(20,21)10-16(22,23)11-17(24,25)26/h1,3-11H2,2H3 |
| InChIKey | WMRZLLCSPKPHDV-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.49 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|