C21H27Cl2FN6O — CID 158062890
azane;[(4S)-4-chloro-5-[[6-(4-fluorophenyl)-3H-indole-2-carbonyl]amino]pentyl]-(diaminomethylidene)azanium;chloride (PubChem CID 158062890) has the molecular formula C21H27Cl2FN6O and a molecular weight of 469.39 g/mol. Its IUPAC name is azane;[(4S)-4-chloro-5-[[6-(4-fluorophenyl)-3H-indole-2-carbonyl]amino]pentyl]-(diaminomethylidene)azanium;chloride.
| Compound Name | azane;[(4S)-4-chloro-5-[[6-(4-fluorophenyl)-3H-indole-2-carbonyl]amino]pentyl]-(diaminomethylidene)azanium;chloride |
|---|---|
| PubChem CID | 158062890 |
| Molecular Formula | C21H27Cl2FN6O |
| Molecular Weight | 469.39 g/mol |
| Exact Mass | 468.16 |
| IUPAC Name | azane;[(4S)-4-chloro-5-[[6-(4-fluorophenyl)-3H-indole-2-carbonyl]amino]pentyl]-(diaminomethylidene)azanium;chloride |
| SMILES | N.NC(N)=[NH+]CCC[C@H](Cl)CNC(=O)C1=Nc2cc(-c3ccc(F)cc3)ccc2C1.[Cl-] |
| InChI | InChI=1S/C21H23ClFN5O.ClH.H3N/c22-16(2-1-9-26-21(24)25)12-27-20(29)19-11-15-4-3-14(10-18(15)28-19)13-5-7-17(23)8-6-13;;/h3-8,10,16H,1-2,9,11-12H2,(H,27,29)(H4,24,25,26);1H;1H3/t16-;;/m0../s1 |
| InChIKey | NGDROSZGDOZFHW-SQKCAUCHSA-N |
| XLogP | -1.85 |
| TPSA | 142.47 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.39 |
| LogP ≤ 5 | -1.85 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|