About methanamine;methyl 3-(2-methyliminobutyl)benzoate;methyl 3-(1-methylsulfanylpropylideneamino)benzoate
methanamine;methyl 3-(2-methyliminobutyl)benzoate;methyl 3-(1-methylsulfanylpropylideneamino)benzoate (PubChem CID 158072356) has the molecular formula C26H37N3O4S
and a molecular weight of 487.67 g/mol. Its IUPAC name is methanamine;methyl 3-(2-methyliminobutyl)benzoate;methyl 3-(1-methylsulfanylpropylideneamino)benzoate.
Molecular Properties
| Compound Name | methanamine;methyl 3-(2-methyliminobutyl)benzoate;methyl 3-(1-methylsulfanylpropylideneamino)benzoate |
| PubChem CID | 158072356 |
| Molecular Formula | C26H37N3O4S |
| Molecular Weight | 487.67 g/mol |
| Exact Mass | 487.25 |
| IUPAC Name | methanamine;methyl 3-(2-methyliminobutyl)benzoate;methyl 3-(1-methylsulfanylpropylideneamino)benzoate |
| SMILES | CC/C(=N\c1cccc(C(=O)OC)c1)SC.CC/C(Cc1cccc(C(=O)OC)c1)=N\C.CN |
| InChI | InChI=1S/C13H17NO2.C12H15NO2S.CH5N/c1-4-12(14-2)9-10-6-5-7-11(8-10)13(15)16-3;1-4-11(16-3)13-10-7-5-6-9(8-10)12(14)15-2;1-2/h5-8H,4,9H2,1-3H3;5-8H,4H2,1-3H3;2H2,1H3/b14-12+;13-11+; |
| InChIKey | FLYXNDRBZUVZAP-KFVQQMEJSA-N |
| XLogP | 5.35 |
| TPSA | 103.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 487.67 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze methanamine;methyl 3-(2-methyliminobutyl)benzoate;methyl 3-(1-methylsulfanylpropylideneamino)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanamine;methyl 3-(2-methyliminobutyl)benzoate;methyl 3-(1-methylsulfanylpropylideneamino)benzoate?
The IUPAC name of methanamine;methyl 3-(2-methyliminobutyl)benzoate;methyl 3-(1-methylsulfanylpropylideneamino)benzoate (CID 158072356) is methanamine;methyl 3-(2-methyliminobutyl)benzoate;methyl 3-(1-methylsulfanylpropylideneamino)benzoate.
What is the SMILES notation for methanamine;methyl 3-(2-methyliminobutyl)benzoate;methyl 3-(1-methylsulfanylpropylideneamino)benzoate?
The canonical SMILES for methanamine;methyl 3-(2-methyliminobutyl)benzoate;methyl 3-(1-methylsulfanylpropylideneamino)benzoate is CC/C(=N\c1cccc(C(=O)OC)c1)SC.CC/C(Cc1cccc(C(=O)OC)c1)=N\C.CN.
What is the InChIKey of methanamine;methyl 3-(2-methyliminobutyl)benzoate;methyl 3-(1-methylsulfanylpropylideneamino)benzoate?
The InChIKey is FLYXNDRBZUVZAP-KFVQQMEJSA-N. The full InChI is InChI=1S/C13H17NO2.C12H15NO2S.CH5N/c1-4-12(14-2)9-10-6-5-7-11(8-10)13(15)16-3;1-4-11(16-3)13-10-7-5-6-9(8-10)12(14)15-2;1-2/h5-8H,4,9H2,1-3H3;5-8H,4H2,1-3H3;2H2,1H3/b14-12+;13-11+;.
What are the key properties of methanamine;methyl 3-(2-methyliminobutyl)benzoate;methyl 3-(1-methylsulfanylpropylideneamino)benzoate?
methanamine;methyl 3-(2-methyliminobutyl)benzoate;methyl 3-(1-methylsulfanylpropylideneamino)benzoate has a molecular weight of 487.67 g/mol, XLogP of 5.35, 7 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for methanamine;methyl 3-(2-methyliminobutyl)benzoate;methyl 3-(1-methylsulfanylpropylideneamino)benzoate is sourced from PubChem (CID 158072356), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).