About 5-amino-1H-pyridin-2-one;5-nitro-1H-pyridin-2-one
5-amino-1H-pyridin-2-one;5-nitro-1H-pyridin-2-one (PubChem CID 158082863) has the molecular formula C10H10N4O4
and a molecular weight of 250.21 g/mol. Its IUPAC name is 5-amino-1H-pyridin-2-one;5-nitro-1H-pyridin-2-one.
Molecular Properties
| Compound Name | 5-amino-1H-pyridin-2-one;5-nitro-1H-pyridin-2-one |
| PubChem CID | 158082863 |
| Molecular Formula | C10H10N4O4 |
| Molecular Weight | 250.21 g/mol |
| Exact Mass | 250.07 |
| IUPAC Name | 5-amino-1H-pyridin-2-one;5-nitro-1H-pyridin-2-one |
| SMILES | Nc1ccc(=O)[nH]c1.O=c1ccc([N+](=O)[O-])c[nH]1 |
| InChI | InChI=1S/C5H4N2O3.C5H6N2O/c8-5-2-1-4(3-6-5)7(9)10;6-4-1-2-5(8)7-3-4/h1-3H,(H,6,8);1-3H,6H2,(H,7,8) |
| InChIKey | FNDYWNZHVBINPU-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 134.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.21 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-amino-1H-pyridin-2-one;5-nitro-1H-pyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-1H-pyridin-2-one;5-nitro-1H-pyridin-2-one?
The IUPAC name of 5-amino-1H-pyridin-2-one;5-nitro-1H-pyridin-2-one (CID 158082863) is 5-amino-1H-pyridin-2-one;5-nitro-1H-pyridin-2-one.
What is the SMILES notation for 5-amino-1H-pyridin-2-one;5-nitro-1H-pyridin-2-one?
The canonical SMILES for 5-amino-1H-pyridin-2-one;5-nitro-1H-pyridin-2-one is Nc1ccc(=O)[nH]c1.O=c1ccc([N+](=O)[O-])c[nH]1.
What is the InChIKey of 5-amino-1H-pyridin-2-one;5-nitro-1H-pyridin-2-one?
The InChIKey is FNDYWNZHVBINPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4N2O3.C5H6N2O/c8-5-2-1-4(3-6-5)7(9)10;6-4-1-2-5(8)7-3-4/h1-3H,(H,6,8);1-3H,6H2,(H,7,8).
What are the key properties of 5-amino-1H-pyridin-2-one;5-nitro-1H-pyridin-2-one?
5-amino-1H-pyridin-2-one;5-nitro-1H-pyridin-2-one has a molecular weight of 250.21 g/mol, XLogP of 0.24, 1 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-1H-pyridin-2-one;5-nitro-1H-pyridin-2-one is sourced from PubChem (CID 158082863), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).