About CID 158126656
CID 158126656 (PubChem CID 158126656) has the molecular formula C40H25BBr2N7O2S9
and a molecular weight of 1094.91 g/mol.
Molecular Properties
| Compound Name | CID 158126656 |
| PubChem CID | 158126656 |
| Molecular Formula | C40H25BBr2N7O2S9 |
| Molecular Weight | 1094.91 g/mol |
| Exact Mass | 1091.80 |
| IUPAC Name | — |
| SMILES | COc1nc(-c2ccc(-c3ccc(Br)s3)s2)nc(-c2ccc(-c3ccc(Br)s3)s2)n1.COc1nc(-c2ccc(-c3cccs3)s2)nc(-c2ccc(-c3cccs3)s2)n1.[B]=NS |
| InChI | InChI=1S/C20H11Br2N3OS4.C20H13N3OS4.BHNS/c1-26-20-24-18(14-4-2-10(27-14)12-6-8-16(21)29-12)23-19(25-20)15-5-3-11(28-15)13-7-9-17(22)30-13;1-24-20-22-18(16-8-6-14(27-16)12-4-2-10-25-12)21-19(23-20)17-9-7-15(28-17)13-5-3-11-26-13;1-2-3/h2-9H,1H3;2-11H,1H3;3H |
| InChIKey | RHXYLJKTOBVXSX-UHFFFAOYSA-N |
| XLogP | 15.30 |
| TPSA | 108.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 61 |
| Complexity | — |
Lipinski Rule of Five
3 violations
| Rule | Value |
| MW ≤ 500 | 1094.91 |
| LogP ≤ 5 | 15.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 18 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze CID 158126656 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 158126656?
The IUPAC name of CID 158126656 (CID 158126656) is not available.
What is the SMILES notation for CID 158126656?
The canonical SMILES for CID 158126656 is COc1nc(-c2ccc(-c3ccc(Br)s3)s2)nc(-c2ccc(-c3ccc(Br)s3)s2)n1.COc1nc(-c2ccc(-c3cccs3)s2)nc(-c2ccc(-c3cccs3)s2)n1.[B]=NS.
What is the InChIKey of CID 158126656?
The InChIKey is RHXYLJKTOBVXSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H11Br2N3OS4.C20H13N3OS4.BHNS/c1-26-20-24-18(14-4-2-10(27-14)12-6-8-16(21)29-12)23-19(25-20)15-5-3-11(28-15)13-7-9-17(22)30-13;1-24-20-22-18(16-8-6-14(27-16)12-4-2-10-25-12)21-19(23-20)17-9-7-15(28-17)13-5-3-11-26-13;1-2-3/h2-9H,1H3;2-11H,1H3;3H.
What are the key properties of CID 158126656?
CID 158126656 has a molecular weight of 1094.91 g/mol, XLogP of 15.30, 10 rotatable bonds, 1 hydrogen bond donors, and 18 hydrogen bond acceptors.
Where does this data come from?
All data for CID 158126656 is sourced from PubChem (CID 158126656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).