C24H27ClN4O2 — CID 158132452
1-phenylpiperidine-4-carboxamide;1-phenylpyridin-1-ium-4-carboxamide;chloride (PubChem CID 158132452) has the molecular formula C24H27ClN4O2 and a molecular weight of 438.96 g/mol. Its IUPAC name is 1-phenylpiperidine-4-carboxamide;1-phenylpyridin-1-ium-4-carboxamide;chloride.
| Compound Name | 1-phenylpiperidine-4-carboxamide;1-phenylpyridin-1-ium-4-carboxamide;chloride |
|---|---|
| PubChem CID | 158132452 |
| Molecular Formula | C24H27ClN4O2 |
| Molecular Weight | 438.96 g/mol |
| Exact Mass | 438.18 |
| IUPAC Name | 1-phenylpiperidine-4-carboxamide;1-phenylpyridin-1-ium-4-carboxamide;chloride |
| SMILES | NC(=O)C1CCN(c2ccccc2)CC1.NC(=O)c1cc[n+](-c2ccccc2)cc1.[Cl-] |
| InChI | InChI=1S/C12H16N2O.C12H10N2O.ClH/c2*13-12(15)10-6-8-14(9-7-10)11-4-2-1-3-5-11;/h1-5,10H,6-9H2,(H2,13,15);1-9H,(H-,13,15);1H |
| InChIKey | KWORPFXVAJIMNX-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 93.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.96 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|