C26H46N2O8 — CID 158136016
tert-butyl N-(3-formylcyclobutyl)carbamate;tert-butyl N-(3-formylcyclobutyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate;methane (PubChem CID 158136016) has the molecular formula C26H46N2O8 and a molecular weight of 514.66 g/mol. Its IUPAC name is tert-butyl N-(3-formylcyclobutyl)carbamate;tert-butyl N-(3-formylcyclobutyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate;methane.
| Compound Name | tert-butyl N-(3-formylcyclobutyl)carbamate;tert-butyl N-(3-formylcyclobutyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate;methane |
|---|---|
| PubChem CID | 158136016 |
| Molecular Formula | C26H46N2O8 |
| Molecular Weight | 514.66 g/mol |
| Exact Mass | 514.33 |
| IUPAC Name | tert-butyl N-(3-formylcyclobutyl)carbamate;tert-butyl N-(3-formylcyclobutyl)-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate;methane |
| SMILES | C.CC(C)(C)OC(=O)N(C(=O)OC(C)(C)C)C1CC(C=O)C1.CC(C)(C)OC(=O)NC1CC(C=O)C1 |
| InChI | InChI=1S/C15H25NO5.C10H17NO3.CH4/c1-14(2,3)20-12(18)16(11-7-10(8-11)9-17)13(19)21-15(4,5)6;1-10(2,3)14-9(13)11-8-4-7(5-8)6-12;/h9-11H,7-8H2,1-6H3;6-8H,4-5H2,1-3H3,(H,11,13);1H4 |
| InChIKey | FTIZCZOYTZNNLM-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 128.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.66 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|