C23H20ClN5O2S — CID 158158675
5-[(3-chlorophenyl)methyl]-3-[[1-(methylidene-oxo-phenyl-λ6-sulfanyl)pyrrol-2-yl]methylideneamino]-1H-pyrazole-4-carboxamide (PubChem CID 158158675) has the molecular formula C23H20ClN5O2S and a molecular weight of 465.97 g/mol. Its IUPAC name is 5-[(3-chlorophenyl)methyl]-3-[[1-(methylidene-oxo-phenyl-λ6-sulfanyl)pyrrol-2-yl]methylideneamino]-1H-pyrazole-4-carboxamide.
| Compound Name | 5-[(3-chlorophenyl)methyl]-3-[[1-(methylidene-oxo-phenyl-λ6-sulfanyl)pyrrol-2-yl]methylideneamino]-1H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 158158675 |
| Molecular Formula | C23H20ClN5O2S |
| Molecular Weight | 465.97 g/mol |
| Exact Mass | 465.10 |
| IUPAC Name | 5-[(3-chlorophenyl)methyl]-3-[[1-(methylidene-oxo-phenyl-λ6-sulfanyl)pyrrol-2-yl]methylideneamino]-1H-pyrazole-4-carboxamide |
| SMILES | C=S(=O)(c1ccccc1)n1cccc1/C=N/c1n[nH]c(Cc2cccc(Cl)c2)c1C(N)=O |
| InChI | InChI=1S/C23H20ClN5O2S/c1-32(31,19-10-3-2-4-11-19)29-12-6-9-18(29)15-26-23-21(22(25)30)20(27-28-23)14-16-7-5-8-17(24)13-16/h2-13,15H,1,14H2,(H2,25,30)(H,27,28)/b26-15+ |
| InChIKey | WMWVRPCYPSSXJS-CVKSISIWSA-N |
| XLogP | 3.84 |
| TPSA | 106.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.97 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|