C13H24OS — CID 158178290
6-tert-butyl-1-methylidene-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]thiopyran 1-oxide (PubChem CID 158178290) has the molecular formula C13H24OS and a molecular weight of 228.40 g/mol. Its IUPAC name is 6-tert-butyl-1-methylidene-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]thiopyran 1-oxide.
| Compound Name | 6-tert-butyl-1-methylidene-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]thiopyran 1-oxide |
|---|---|
| PubChem CID | 158178290 |
| Molecular Formula | C13H24OS |
| Molecular Weight | 228.40 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | 6-tert-butyl-1-methylidene-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]thiopyran 1-oxide |
| SMILES | C=S1(=O)CCCC2CC(C(C)(C)C)CC21 |
| InChI | InChI=1S/C13H24OS/c1-13(2,3)11-8-10-6-5-7-15(4,14)12(10)9-11/h10-12H,4-9H2,1-3H3 |
| InChIKey | XKBXWLNDCXZCLW-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.40 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|