C7H12F3NO3S — CID 158194058
(3R)-1-(trifluoromethoxy)hex-5-ene-3-sulfonamide (PubChem CID 158194058) has the molecular formula C7H12F3NO3S and a molecular weight of 247.24 g/mol. Its IUPAC name is (3R)-1-(trifluoromethoxy)hex-5-ene-3-sulfonamide.
| Compound Name | (3R)-1-(trifluoromethoxy)hex-5-ene-3-sulfonamide |
|---|---|
| PubChem CID | 158194058 |
| Molecular Formula | C7H12F3NO3S |
| Molecular Weight | 247.24 g/mol |
| Exact Mass | 247.05 |
| IUPAC Name | (3R)-1-(trifluoromethoxy)hex-5-ene-3-sulfonamide |
| SMILES | C=CC[C@H](CCOC(F)(F)F)S(N)(=O)=O |
| InChI | InChI=1S/C7H12F3NO3S/c1-2-3-6(15(11,12)13)4-5-14-7(8,9)10/h2,6H,1,3-5H2,(H2,11,12,13)/t6-/m1/s1 |
| InChIKey | OLJSDQZTBZVECG-ZCFIWIBFSA-N |
| XLogP | 1.15 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.24 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|