C15H14 — CID 158195355
5,8-dimethyl-1H-phenalene (PubChem CID 158195355) has the molecular formula C15H14 and a molecular weight of 194.28 g/mol. Its IUPAC name is 5,8-dimethyl-1H-phenalene.
| Compound Name | 5,8-dimethyl-1H-phenalene |
|---|---|
| PubChem CID | 158195355 |
| Molecular Formula | C15H14 |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | 5,8-dimethyl-1H-phenalene |
| SMILES | Cc1cc2c3c(cc(C)cc3c1)CC=C2 |
| InChI | InChI=1S/C15H14/c1-10-6-12-4-3-5-13-7-11(2)9-14(8-10)15(12)13/h3-4,6-9H,5H2,1-2H3 |
| InChIKey | YNRQEFRLHZGARD-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |