About N,N-dimethylacetamide;1,3-dioxolan-2-one
N,N-dimethylacetamide;1,3-dioxolan-2-one (PubChem CID 158215912) has the molecular formula C7H13NO4
and a molecular weight of 175.18 g/mol. Its IUPAC name is N,N-dimethylacetamide;1,3-dioxolan-2-one.
Molecular Properties
| Compound Name | N,N-dimethylacetamide;1,3-dioxolan-2-one |
| PubChem CID | 158215912 |
| Molecular Formula | C7H13NO4 |
| Molecular Weight | 175.18 g/mol |
| Exact Mass | 175.08 |
| IUPAC Name | N,N-dimethylacetamide;1,3-dioxolan-2-one |
| SMILES | CC(=O)N(C)C.O=C1OCCO1 |
| InChI | InChI=1S/C4H9NO.C3H4O3/c1-4(6)5(2)3;4-3-5-1-2-6-3/h1-3H3;1-2H2 |
| InChIKey | GCQHVBUHJOHWQY-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.18 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N,N-dimethylacetamide;1,3-dioxolan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethylacetamide;1,3-dioxolan-2-one?
The IUPAC name of N,N-dimethylacetamide;1,3-dioxolan-2-one (CID 158215912) is N,N-dimethylacetamide;1,3-dioxolan-2-one.
What is the SMILES notation for N,N-dimethylacetamide;1,3-dioxolan-2-one?
The canonical SMILES for N,N-dimethylacetamide;1,3-dioxolan-2-one is CC(=O)N(C)C.O=C1OCCO1.
What is the InChIKey of N,N-dimethylacetamide;1,3-dioxolan-2-one?
The InChIKey is GCQHVBUHJOHWQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9NO.C3H4O3/c1-4(6)5(2)3;4-3-5-1-2-6-3/h1-3H3;1-2H2.
What are the key properties of N,N-dimethylacetamide;1,3-dioxolan-2-one?
N,N-dimethylacetamide;1,3-dioxolan-2-one has a molecular weight of 175.18 g/mol, XLogP of 0.25, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylacetamide;1,3-dioxolan-2-one is sourced from PubChem (CID 158215912), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).