C14H13NO — CID 158232023
3-(4,6-dimethyl-1H-inden-2-yl)-3-oxopropanenitrile (PubChem CID 158232023) has the molecular formula C14H13NO and a molecular weight of 211.26 g/mol. Its IUPAC name is 3-(4,6-dimethyl-1H-inden-2-yl)-3-oxopropanenitrile.
| Compound Name | 3-(4,6-dimethyl-1H-inden-2-yl)-3-oxopropanenitrile |
|---|---|
| PubChem CID | 158232023 |
| Molecular Formula | C14H13NO |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | 3-(4,6-dimethyl-1H-inden-2-yl)-3-oxopropanenitrile |
| SMILES | Cc1cc(C)c2c(c1)CC(C(=O)CC#N)=C2 |
| InChI | InChI=1S/C14H13NO/c1-9-5-10(2)13-8-12(7-11(13)6-9)14(16)3-4-15/h5-6,8H,3,7H2,1-2H3 |
| InChIKey | GEMLXQBGYRNZJT-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |