C15H30F6N2O4S2 — CID 158232505
bis(trifluoromethylsulfonyl)azanide;(2-methyl-3-propan-2-ylnonan-3-yl)azanium (PubChem CID 158232505) has the molecular formula C15H30F6N2O4S2 and a molecular weight of 480.54 g/mol. Its IUPAC name is bis(trifluoromethylsulfonyl)azanide;(2-methyl-3-propan-2-ylnonan-3-yl)azanium.
| Compound Name | bis(trifluoromethylsulfonyl)azanide;(2-methyl-3-propan-2-ylnonan-3-yl)azanium |
|---|---|
| PubChem CID | 158232505 |
| Molecular Formula | C15H30F6N2O4S2 |
| Molecular Weight | 480.54 g/mol |
| Exact Mass | 480.16 |
| IUPAC Name | bis(trifluoromethylsulfonyl)azanide;(2-methyl-3-propan-2-ylnonan-3-yl)azanium |
| SMILES | CCCCCCC([NH3+])(C(C)C)C(C)C.O=S(=O)([N-]S(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C13H29N.C2F6NO4S2/c1-6-7-8-9-10-13(14,11(2)3)12(4)5;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h11-12H,6-10,14H2,1-5H3;/q;-1/p+1 |
| InChIKey | GEOAOFZQTNSGEF-UHFFFAOYSA-O |
| XLogP | 4.31 |
| TPSA | 110.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.54 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|