C21H31NO2S — CID 158244469
[4-(2-tert-butylphenyl)piperidin-1-yl]-(1-methylidene-1-oxothiolan-2-yl)methanone (PubChem CID 158244469) has the molecular formula C21H31NO2S and a molecular weight of 361.55 g/mol. Its IUPAC name is [4-(2-tert-butylphenyl)piperidin-1-yl]-(1-methylidene-1-oxothiolan-2-yl)methanone.
| Compound Name | [4-(2-tert-butylphenyl)piperidin-1-yl]-(1-methylidene-1-oxothiolan-2-yl)methanone |
|---|---|
| PubChem CID | 158244469 |
| Molecular Formula | C21H31NO2S |
| Molecular Weight | 361.55 g/mol |
| Exact Mass | 361.21 |
| IUPAC Name | [4-(2-tert-butylphenyl)piperidin-1-yl]-(1-methylidene-1-oxothiolan-2-yl)methanone |
| SMILES | C=S1(=O)CCCC1C(=O)N1CCC(c2ccccc2C(C)(C)C)CC1 |
| InChI | InChI=1S/C21H31NO2S/c1-21(2,3)18-9-6-5-8-17(18)16-11-13-22(14-12-16)20(23)19-10-7-15-25(19,4)24/h5-6,8-9,16,19H,4,7,10-15H2,1-3H3 |
| InChIKey | NVSYNWCWVKACSF-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.55 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|