C22H32N2O3 — CID 158261114
4-hydroxy-4-(2-oxopropyl)-N-[3-(5,6,7,8-tetrahydroquinolin-2-yl)propyl]cyclohexane-1-carboxamide (PubChem CID 158261114) has the molecular formula C22H32N2O3 and a molecular weight of 372.51 g/mol. Its IUPAC name is 4-hydroxy-4-(2-oxopropyl)-N-[3-(5,6,7,8-tetrahydroquinolin-2-yl)propyl]cyclohexane-1-carboxamide.
| Compound Name | 4-hydroxy-4-(2-oxopropyl)-N-[3-(5,6,7,8-tetrahydroquinolin-2-yl)propyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 158261114 |
| Molecular Formula | C22H32N2O3 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.24 |
| IUPAC Name | 4-hydroxy-4-(2-oxopropyl)-N-[3-(5,6,7,8-tetrahydroquinolin-2-yl)propyl]cyclohexane-1-carboxamide |
| SMILES | CC(=O)CC1(O)CCC(C(=O)NCCCc2ccc3c(n2)CCCC3)CC1 |
| InChI | InChI=1S/C22H32N2O3/c1-16(25)15-22(27)12-10-18(11-13-22)21(26)23-14-4-6-19-9-8-17-5-2-3-7-20(17)24-19/h8-9,18,27H,2-7,10-15H2,1H3,(H,23,26) |
| InChIKey | ALWMFPLXLFEXAF-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|