C29H44N6O8S — CID 158265715
3-benzyl-12-(5-iminohexyl)-1,6-dimethyl-16-propan-2-yl-1,4,7,10,13-pentazacyclohexadecane-2,5,8,11,15-pentone;sulfur trioxide (PubChem CID 158265715) has the molecular formula C29H44N6O8S and a molecular weight of 636.77 g/mol. Its IUPAC name is 3-benzyl-12-(5-iminohexyl)-1,6-dimethyl-16-propan-2-yl-1,4,7,10,13-pentazacyclohexadecane-2,5,8,11,15-pentone;sulfur trioxide.
| Compound Name | 3-benzyl-12-(5-iminohexyl)-1,6-dimethyl-16-propan-2-yl-1,4,7,10,13-pentazacyclohexadecane-2,5,8,11,15-pentone;sulfur trioxide |
|---|---|
| PubChem CID | 158265715 |
| Molecular Formula | C29H44N6O8S |
| Molecular Weight | 636.77 g/mol |
| Exact Mass | 636.29 |
| IUPAC Name | 3-benzyl-12-(5-iminohexyl)-1,6-dimethyl-16-propan-2-yl-1,4,7,10,13-pentazacyclohexadecane-2,5,8,11,15-pentone;sulfur trioxide |
| SMILES | O=S(=O)=O.[H]/N=C(\C)CCCCC1NCC(=O)C(C(C)C)N(C)C(=O)C(Cc2ccccc2)NC(=O)C(C)NC(=O)CNC1=O |
| InChI | InChI=1S/C29H44N6O5.O3S/c1-18(2)26-24(36)16-31-22(14-10-9-11-19(3)30)28(39)32-17-25(37)33-20(4)27(38)34-23(29(40)35(26)5)15-21-12-7-6-8-13-21;1-4(2)3/h6-8,12-13,18,20,22-23,26,30-31H,9-11,14-17H2,1-5H3,(H,32,39)(H,33,37)(H,34,38);/b30-19+; |
| InChIKey | GIKKCMYKLNYUER-QUIZVCAPSA-N |
| XLogP | -0.05 |
| TPSA | 211.77 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.77 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|