C27H39N7O5 — CID 58363700
CID 58363700 (PubChem CID 58363700) has the molecular formula C27H39N7O5 and a molecular weight of 541.65 g/mol.
| Compound Name | CID 58363700 |
|---|---|
| PubChem CID | 58363700 |
| Molecular Formula | C27H39N7O5 |
| Molecular Weight | 541.65 g/mol |
| Exact Mass | 541.30 |
| IUPAC Name | — |
| SMILES | [H]/N=C(\N)CCCCC1NC(=O)C(C(C)C)N(C)C(=O)C(Cc2ccccc2)NC(=O)C([CH])NC(=O)CNC1=O |
| InChI | InChI=1S/C27H39N7O5/c1-16(2)23-26(38)32-19(12-8-9-13-21(28)29)25(37)30-15-22(35)31-17(3)24(36)33-20(27(39)34(23)4)14-18-10-6-5-7-11-18/h3,5-7,10-11,16-17,19-20,23H,8-9,12-15H2,1-2,4H3,(H3,28,29)(H,30,37)(H,31,35)(H,32,38)(H,33,36) |
| InChIKey | FKXFBVPRMYXZTR-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 186.58 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.65 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|