C28H43N7O5 — CID 158302220
5-(11-benzyl-8,13-dimethyl-3,6,9,12,15-pentaoxo-14-propan-2-yl-1,4,7,10,13-pentazacyclohexadec-2-yl)pentanimidamide (PubChem CID 158302220) has the molecular formula C28H43N7O5 and a molecular weight of 557.70 g/mol. Its IUPAC name is 5-(11-benzyl-8,13-dimethyl-3,6,9,12,15-pentaoxo-14-propan-2-yl-1,4,7,10,13-pentazacyclohexadec-2-yl)pentanimidamide.
| Compound Name | 5-(11-benzyl-8,13-dimethyl-3,6,9,12,15-pentaoxo-14-propan-2-yl-1,4,7,10,13-pentazacyclohexadec-2-yl)pentanimidamide |
|---|---|
| PubChem CID | 158302220 |
| Molecular Formula | C28H43N7O5 |
| Molecular Weight | 557.70 g/mol |
| Exact Mass | 557.33 |
| IUPAC Name | 5-(11-benzyl-8,13-dimethyl-3,6,9,12,15-pentaoxo-14-propan-2-yl-1,4,7,10,13-pentazacyclohexadec-2-yl)pentanimidamide |
| SMILES | [H]/N=C(\N)CCCCC1NCC(=O)C(C(C)C)N(C)C(=O)C(Cc2ccccc2)NC(=O)C(C)NC(=O)CNC1=O |
| InChI | InChI=1S/C28H43N7O5/c1-17(2)25-22(36)15-31-20(12-8-9-13-23(29)30)27(39)32-16-24(37)33-18(3)26(38)34-21(28(40)35(25)4)14-19-10-6-5-7-11-19/h5-7,10-11,17-18,20-21,25,31H,8-9,12-16H2,1-4H3,(H3,29,30)(H,32,39)(H,33,37)(H,34,38) |
| InChIKey | NDHLRUCXQZIZDN-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 186.58 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.70 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|