C29H44N6O5 — CID 158265716
3-benzyl-12-(5-iminohexyl)-1,6-dimethyl-16-propan-2-yl-1,4,7,10,13-pentazacyclohexadecane-2,5,8,11,15-pentone (PubChem CID 158265716) has the molecular formula C29H44N6O5 and a molecular weight of 556.71 g/mol. Its IUPAC name is 3-benzyl-12-(5-iminohexyl)-1,6-dimethyl-16-propan-2-yl-1,4,7,10,13-pentazacyclohexadecane-2,5,8,11,15-pentone.
| Compound Name | 3-benzyl-12-(5-iminohexyl)-1,6-dimethyl-16-propan-2-yl-1,4,7,10,13-pentazacyclohexadecane-2,5,8,11,15-pentone |
|---|---|
| PubChem CID | 158265716 |
| Molecular Formula | C29H44N6O5 |
| Molecular Weight | 556.71 g/mol |
| Exact Mass | 556.34 |
| IUPAC Name | 3-benzyl-12-(5-iminohexyl)-1,6-dimethyl-16-propan-2-yl-1,4,7,10,13-pentazacyclohexadecane-2,5,8,11,15-pentone |
| SMILES | [H]/N=C(\C)CCCCC1NCC(=O)C(C(C)C)N(C)C(=O)C(Cc2ccccc2)NC(=O)C(C)NC(=O)CNC1=O |
| InChI | InChI=1S/C29H44N6O5/c1-18(2)26-24(36)16-31-22(14-10-9-11-19(3)30)28(39)32-17-25(37)33-20(4)27(38)34-23(29(40)35(26)5)15-21-12-7-6-8-13-21/h6-8,12-13,18,20,22-23,26,30-31H,9-11,14-17H2,1-5H3,(H,32,39)(H,33,37)(H,34,38)/b30-19+ |
| InChIKey | QSYIWNAFYAFYEB-NDZAJKAJSA-N |
| XLogP | 0.96 |
| TPSA | 160.56 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.71 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|