C33H31BrO10 — CID 158285696
(2,4-dihydroxyphenyl)-phenylmethanone;ethyl 2-bromoacetate;methyl 2-(4-benzoyl-3-hydroxyphenoxy)acetate (PubChem CID 158285696) has the molecular formula C33H31BrO10 and a molecular weight of 667.50 g/mol. Its IUPAC name is (2,4-dihydroxyphenyl)-phenylmethanone;ethyl 2-bromoacetate;methyl 2-(4-benzoyl-3-hydroxyphenoxy)acetate.
| Compound Name | (2,4-dihydroxyphenyl)-phenylmethanone;ethyl 2-bromoacetate;methyl 2-(4-benzoyl-3-hydroxyphenoxy)acetate |
|---|---|
| PubChem CID | 158285696 |
| Molecular Formula | C33H31BrO10 |
| Molecular Weight | 667.50 g/mol |
| Exact Mass | 666.11 |
| IUPAC Name | (2,4-dihydroxyphenyl)-phenylmethanone;ethyl 2-bromoacetate;methyl 2-(4-benzoyl-3-hydroxyphenoxy)acetate |
| SMILES | CCOC(=O)CBr.COC(=O)COc1ccc(C(=O)c2ccccc2)c(O)c1.O=C(c1ccccc1)c1ccc(O)cc1O |
| InChI | InChI=1S/C16H14O5.C13H10O3.C4H7BrO2/c1-20-15(18)10-21-12-7-8-13(14(17)9-12)16(19)11-5-3-2-4-6-11;14-10-6-7-11(12(15)8-10)13(16)9-4-2-1-3-5-9;1-2-7-4(6)3-5/h2-9,17H,10H2,1H3;1-8,14-15H;2-3H2,1H3 |
| InChIKey | GKTFNOBFKCCPKV-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 156.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.50 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|