C29H41BBrClN6O5 — CID 158328210
1-bromo-2-methoxyethane;2-chloro-7-[1-(2-methoxyethyl)pyrazol-4-yl]-1,5-naphthyridine;1-(2-methoxyethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole (PubChem CID 158328210) has the molecular formula C29H41BBrClN6O5 and a molecular weight of 679.85 g/mol. Its IUPAC name is 1-bromo-2-methoxyethane;2-chloro-7-[1-(2-methoxyethyl)pyrazol-4-yl]-1,5-naphthyridine;1-(2-methoxyethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole.
| Compound Name | 1-bromo-2-methoxyethane;2-chloro-7-[1-(2-methoxyethyl)pyrazol-4-yl]-1,5-naphthyridine;1-(2-methoxyethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole |
|---|---|
| PubChem CID | 158328210 |
| Molecular Formula | C29H41BBrClN6O5 |
| Molecular Weight | 679.85 g/mol |
| Exact Mass | 678.21 |
| IUPAC Name | 1-bromo-2-methoxyethane;2-chloro-7-[1-(2-methoxyethyl)pyrazol-4-yl]-1,5-naphthyridine;1-(2-methoxyethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole |
| SMILES | COCCBr.COCCn1cc(-c2cnc3ccc(Cl)nc3c2)cn1.COCCn1cc(B2OC(C)(C)C(C)(C)O2)cn1 |
| InChI | InChI=1S/C14H13ClN4O.C12H21BN2O3.C3H7BrO/c1-20-5-4-19-9-11(8-17-19)10-6-13-12(16-7-10)2-3-14(15)18-13;1-11(2)12(3,4)18-13(17-11)10-8-14-15(9-10)6-7-16-5;1-5-3-2-4/h2-3,6-9H,4-5H2,1H3;8-9H,6-7H2,1-5H3;2-3H2,1H3 |
| InChIKey | GPRFQGRBNONRRL-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 107.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.85 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|