C12H22 — CID 158350500
2,6,8-trimethylnon-3-yne (PubChem CID 158350500) has the molecular formula C12H22 and a molecular weight of 166.31 g/mol. Its IUPAC name is 2,6,8-trimethylnon-3-yne.
| Compound Name | 2,6,8-trimethylnon-3-yne |
|---|---|
| PubChem CID | 158350500 |
| Molecular Formula | C12H22 |
| Molecular Weight | 166.31 g/mol |
| Exact Mass | 166.17 |
| IUPAC Name | 2,6,8-trimethylnon-3-yne |
| SMILES | CC(C)C#CCC(C)CC(C)C |
| InChI | InChI=1S/C12H22/c1-10(2)7-6-8-12(5)9-11(3)4/h10-12H,8-9H2,1-5H3 |
| InChIKey | ADNVIUNEMCGUJT-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.31 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|