C16H23NO8 — CID 158355472
5-[1-(dimethylamino)ethylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione;2,2-dimethyl-1,3-dioxane-4,6-dione (PubChem CID 158355472) has the molecular formula C16H23NO8 and a molecular weight of 357.36 g/mol. Its IUPAC name is 5-[1-(dimethylamino)ethylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione;2,2-dimethyl-1,3-dioxane-4,6-dione.
| Compound Name | 5-[1-(dimethylamino)ethylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione;2,2-dimethyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 158355472 |
| Molecular Formula | C16H23NO8 |
| Molecular Weight | 357.36 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | 5-[1-(dimethylamino)ethylidene]-2,2-dimethyl-1,3-dioxane-4,6-dione;2,2-dimethyl-1,3-dioxane-4,6-dione |
| SMILES | CC(=C1C(=O)OC(C)(C)OC1=O)N(C)C.CC1(C)OC(=O)CC(=O)O1 |
| InChI | InChI=1S/C10H15NO4.C6H8O4/c1-6(11(4)5)7-8(12)14-10(2,3)15-9(7)13;1-6(2)9-4(7)3-5(8)10-6/h1-5H3;3H2,1-2H3 |
| InChIKey | GSUYGHUPCJQMRK-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 108.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.36 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|