C6H9O4+ — CID 147724885
(2,2-dimethyl-6-oxo-1,3-dioxan-4-ylidene)oxidanium (PubChem CID 147724885) has the molecular formula C6H9O4+ and a molecular weight of 145.13 g/mol. Its IUPAC name is (2,2-dimethyl-6-oxo-1,3-dioxan-4-ylidene)oxidanium.
| Compound Name | (2,2-dimethyl-6-oxo-1,3-dioxan-4-ylidene)oxidanium |
|---|---|
| PubChem CID | 147724885 |
| Molecular Formula | C6H9O4+ |
| Molecular Weight | 145.13 g/mol |
| Exact Mass | 145.05 |
| IUPAC Name | (2,2-dimethyl-6-oxo-1,3-dioxan-4-ylidene)oxidanium |
| SMILES | [H]/[O+]=C1\CC(=O)OC(C)(C)O1 |
| InChI | InChI=1S/C6H8O4/c1-6(2)9-4(7)3-5(8)10-6/h3H2,1-2H3/p+1 |
| InChIKey | GXHFUVWIGNLZSC-UHFFFAOYSA-O |
| XLogP | 0.19 |
| TPSA | 56.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.13 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|