C20H17FINO3 — CID 158356410
2-[7a-(2-fluoro-5-iodophenyl)-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]oxazin-2-yl]-1-phenylethanone (PubChem CID 158356410) has the molecular formula C20H17FINO3 and a molecular weight of 465.26 g/mol. Its IUPAC name is 2-[7a-(2-fluoro-5-iodophenyl)-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]oxazin-2-yl]-1-phenylethanone.
| Compound Name | 2-[7a-(2-fluoro-5-iodophenyl)-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]oxazin-2-yl]-1-phenylethanone |
|---|---|
| PubChem CID | 158356410 |
| Molecular Formula | C20H17FINO3 |
| Molecular Weight | 465.26 g/mol |
| Exact Mass | 465.02 |
| IUPAC Name | 2-[7a-(2-fluoro-5-iodophenyl)-4,4a,5,7-tetrahydrofuro[3,4-d][1,3]oxazin-2-yl]-1-phenylethanone |
| SMILES | O=C(CC1=NC2(c3cc(I)ccc3F)COCC2CO1)c1ccccc1 |
| InChI | InChI=1S/C20H17FINO3/c21-17-7-6-15(22)8-16(17)20-12-25-10-14(20)11-26-19(23-20)9-18(24)13-4-2-1-3-5-13/h1-8,14H,9-12H2 |
| InChIKey | YPLRBQOYBTVCKP-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.26 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|