C20H44ClNO — CID 158390492
[(2S,3R)-3-hydroxyicosan-2-yl]azanium chloride (PubChem CID 158390492) has the molecular formula C20H44ClNO and a molecular weight of 350.03 g/mol. Its IUPAC name is [(2S,3R)-3-hydroxyicosan-2-yl]azanium chloride.
| Compound Name | [(2S,3R)-3-hydroxyicosan-2-yl]azanium chloride |
|---|---|
| PubChem CID | 158390492 |
| Molecular Formula | C20H44ClNO |
| Molecular Weight | 350.03 g/mol |
| Exact Mass | 349.31 |
| IUPAC Name | [(2S,3R)-3-hydroxyicosan-2-yl]azanium chloride |
| SMILES | CCCCCCCCCCCCCCCCC[C@@H](O)[C@H](C)[NH3+].[Cl-] |
| InChI | InChI=1S/C20H43NO.ClH/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-20(22)19(2)21;/h19-20,22H,3-18,21H2,1-2H3;1H/t19-,20+;/m0./s1 |
| InChIKey | WTBBWNYCZKVGTB-CMXBXVFLSA-N |
| XLogP | 2.24 |
| TPSA | 47.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.03 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|